C12H25N5 — CID 114526861
N-[[1-[3-(dimethylamino)propyl]triazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 114526861) has the molecular formula C12H25N5 and a molecular weight of 239.37 g/mol. Its IUPAC name is N-[[1-[3-(dimethylamino)propyl]triazol-4-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-[3-(dimethylamino)propyl]triazol-4-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 114526861 |
| Molecular Formula | C12H25N5 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.21 |
| IUPAC Name | N-[[1-[3-(dimethylamino)propyl]triazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CN(C)CCCn1cc(CNC(C)(C)C)nn1 |
| InChI | InChI=1S/C12H25N5/c1-12(2,3)13-9-11-10-17(15-14-11)8-6-7-16(4)5/h10,13H,6-9H2,1-5H3 |
| InChIKey | MJKDCSTWDFCGOC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |