C11H22N4O2S — CID 66194438
2-methyl-N-[[1-(3-methylsulfonylpropyl)triazol-4-yl]methyl]propan-2-amine (PubChem CID 66194438) has the molecular formula C11H22N4O2S and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-methyl-N-[[1-(3-methylsulfonylpropyl)triazol-4-yl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[1-(3-methylsulfonylpropyl)triazol-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66194438 |
| Molecular Formula | C11H22N4O2S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2-methyl-N-[[1-(3-methylsulfonylpropyl)triazol-4-yl]methyl]propan-2-amine |
| SMILES | CC(C)(C)NCc1cn(CCCS(C)(=O)=O)nn1 |
| InChI | InChI=1S/C11H22N4O2S/c1-11(2,3)12-8-10-9-15(14-13-10)6-5-7-18(4,16)17/h9,12H,5-8H2,1-4H3 |
| InChIKey | LMBBNLXUHFDIEE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |