C13H20N4S — CID 66192264
2-methyl-N-[[1-(2-thiophen-3-ylethyl)triazol-4-yl]methyl]propan-2-amine (PubChem CID 66192264) has the molecular formula C13H20N4S and a molecular weight of 264.40 g/mol. Its IUPAC name is 2-methyl-N-[[1-(2-thiophen-3-ylethyl)triazol-4-yl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[1-(2-thiophen-3-ylethyl)triazol-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66192264 |
| Molecular Formula | C13H20N4S |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-methyl-N-[[1-(2-thiophen-3-ylethyl)triazol-4-yl]methyl]propan-2-amine |
| SMILES | CC(C)(C)NCc1cn(CCc2ccsc2)nn1 |
| InChI | InChI=1S/C13H20N4S/c1-13(2,3)14-8-12-9-17(16-15-12)6-4-11-5-7-18-10-11/h5,7,9-10,14H,4,6,8H2,1-3H3 |
| InChIKey | RZLMMLQVXVQJNV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |