C15H29N5 — CID 62438721
N-[[1-[2-(azepan-1-yl)ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 62438721) has the molecular formula C15H29N5 and a molecular weight of 279.43 g/mol. Its IUPAC name is N-[[1-[2-(azepan-1-yl)ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-[2-(azepan-1-yl)ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 62438721 |
| Molecular Formula | C15H29N5 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | N-[[1-[2-(azepan-1-yl)ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cn(CCN2CCCCCC2)nn1 |
| InChI | InChI=1S/C15H29N5/c1-15(2,3)16-12-14-13-20(18-17-14)11-10-19-8-6-4-5-7-9-19/h13,16H,4-12H2,1-3H3 |
| InChIKey | WDWFQXVOWUARPI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |