C10H19N5 — CID 62438466
N-methyl-1-[1-(2-pyrrolidin-1-ylethyl)triazol-4-yl]methanamine (PubChem CID 62438466) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is N-methyl-1-[1-(2-pyrrolidin-1-ylethyl)triazol-4-yl]methanamine.
| Compound Name | N-methyl-1-[1-(2-pyrrolidin-1-ylethyl)triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 62438466 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | N-methyl-1-[1-(2-pyrrolidin-1-ylethyl)triazol-4-yl]methanamine |
| SMILES | CNCc1cn(CCN2CCCC2)nn1 |
| InChI | InChI=1S/C10H19N5/c1-11-8-10-9-15(13-12-10)7-6-14-4-2-3-5-14/h9,11H,2-8H2,1H3 |
| InChIKey | FBAFZVOGOYWIPC-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |