C14H29N5 — CID 62422705
N-[[1-[2-[ethyl(propyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 62422705) has the molecular formula C14H29N5 and a molecular weight of 267.42 g/mol. Its IUPAC name is N-[[1-[2-[ethyl(propyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-[2-[ethyl(propyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 62422705 |
| Molecular Formula | C14H29N5 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.24 |
| IUPAC Name | N-[[1-[2-[ethyl(propyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CCCN(CC)CCn1cc(CNC(C)(C)C)nn1 |
| InChI | InChI=1S/C14H29N5/c1-6-8-18(7-2)9-10-19-12-13(16-17-19)11-15-14(3,4)5/h12,15H,6-11H2,1-5H3 |
| InChIKey | JKUXXUGKBLZRPN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |