C16H31N5 — CID 62428805
N-[[1-[2-[cyclopropylmethyl(propyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 62428805) has the molecular formula C16H31N5 and a molecular weight of 293.46 g/mol. Its IUPAC name is N-[[1-[2-[cyclopropylmethyl(propyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-[2-[cyclopropylmethyl(propyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 62428805 |
| Molecular Formula | C16H31N5 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.26 |
| IUPAC Name | N-[[1-[2-[cyclopropylmethyl(propyl)amino]ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CCCN(CCn1cc(CNC(C)(C)C)nn1)CC1CC1 |
| InChI | InChI=1S/C16H31N5/c1-5-8-20(12-14-6-7-14)9-10-21-13-15(18-19-21)11-17-16(2,3)4/h13-14,17H,5-12H2,1-4H3 |
| InChIKey | YVWGJFWMHJQOGX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |