C10H14F2N2OS — CID 106476108
2-[2-(2,2-difluoroethoxy)ethyl]-6-ethyl-1H-pyrimidine-4-thione (PubChem CID 106476108) has the molecular formula C10H14F2N2OS and a molecular weight of 248.30 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-6-ethyl-1H-pyrimidine-4-thione.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-ethyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476108 |
| Molecular Formula | C10H14F2N2OS |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-ethyl-1H-pyrimidine-4-thione |
| SMILES | CCc1cc(=S)nc(CCOCC(F)F)[nH]1 |
| InChI | InChI=1S/C10H14F2N2OS/c1-2-7-5-10(16)14-9(13-7)3-4-15-6-8(11)12/h5,8H,2-4,6H2,1H3,(H,13,14,16) |
| InChIKey | MEEPWAGUMSYKCS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|