C10H13F2IN2O2 — CID 136842459
2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-5-iodo-1H-pyrimidin-6-one (PubChem CID 136842459) has the molecular formula C10H13F2IN2O2 and a molecular weight of 358.13 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842459 |
| Molecular Formula | C10H13F2IN2O2 |
| Molecular Weight | 358.13 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCc1nc(CCOCC(F)F)[nH]c(=O)c1I |
| InChI | InChI=1S/C10H13F2IN2O2/c1-2-6-9(13)10(16)15-8(14-6)3-4-17-5-7(11)12/h7H,2-5H2,1H3,(H,14,15,16) |
| InChIKey | OLQBKKPMZIDITQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.13 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|