C12H18F2IN3O — CID 103150418
2-[2-(2,2-difluoroethoxy)ethyl]-N,6-diethyl-5-iodopyrimidin-4-amine (PubChem CID 103150418) has the molecular formula C12H18F2IN3O and a molecular weight of 385.20 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-N,6-diethyl-5-iodopyrimidin-4-amine.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-N,6-diethyl-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 103150418 |
| Molecular Formula | C12H18F2IN3O |
| Molecular Weight | 385.20 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-N,6-diethyl-5-iodopyrimidin-4-amine |
| SMILES | CCNc1nc(CCOCC(F)F)nc(CC)c1I |
| InChI | InChI=1S/C12H18F2IN3O/c1-3-8-11(15)12(16-4-2)18-10(17-8)5-6-19-7-9(13)14/h9H,3-7H2,1-2H3,(H,16,17,18) |
| InChIKey | OTOVFHWOZMOSRV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|