C12H19F2N3O — CID 103150327
2-[2-(2,2-difluoroethoxy)ethyl]-N-ethyl-5,6-dimethylpyrimidin-4-amine (PubChem CID 103150327) has the molecular formula C12H19F2N3O and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-N-ethyl-5,6-dimethylpyrimidin-4-amine.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-N-ethyl-5,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 103150327 |
| Molecular Formula | C12H19F2N3O |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-N-ethyl-5,6-dimethylpyrimidin-4-amine |
| SMILES | CCNc1nc(CCOCC(F)F)nc(C)c1C |
| InChI | InChI=1S/C12H19F2N3O/c1-4-15-12-8(2)9(3)16-11(17-12)5-6-18-7-10(13)14/h10H,4-7H2,1-3H3,(H,15,16,17) |
| InChIKey | VHJFTBGXSJUXFQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|