C10H13F2N3O3 — CID 103151376
4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-methylpyrimidine-5-carboxylic acid (PubChem CID 103151376) has the molecular formula C10H13F2N3O3 and a molecular weight of 261.23 g/mol. Its IUPAC name is 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-methylpyrimidine-5-carboxylic acid.
| Compound Name | 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-methylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 103151376 |
| Molecular Formula | C10H13F2N3O3 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-methylpyrimidine-5-carboxylic acid |
| SMILES | Cc1nc(CCOCC(F)F)nc(N)c1C(=O)O |
| InChI | InChI=1S/C10H13F2N3O3/c1-5-8(10(16)17)9(13)15-7(14-5)2-3-18-4-6(11)12/h6H,2-4H2,1H3,(H,16,17)(H2,13,14,15) |
| InChIKey | QPTNLABOZJULOJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|