C11H16F2N2O2 — CID 103150772
1-[2-[2-(2,2-difluoroethoxy)ethyl]-4-methylpyrimidin-5-yl]ethanol (PubChem CID 103150772) has the molecular formula C11H16F2N2O2 and a molecular weight of 246.26 g/mol. Its IUPAC name is 1-[2-[2-(2,2-difluoroethoxy)ethyl]-4-methylpyrimidin-5-yl]ethanol.
| Compound Name | 1-[2-[2-(2,2-difluoroethoxy)ethyl]-4-methylpyrimidin-5-yl]ethanol |
|---|---|
| PubChem CID | 103150772 |
| Molecular Formula | C11H16F2N2O2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-[2-[2-(2,2-difluoroethoxy)ethyl]-4-methylpyrimidin-5-yl]ethanol |
| SMILES | Cc1nc(CCOCC(F)F)ncc1C(C)O |
| InChI | InChI=1S/C11H16F2N2O2/c1-7-9(8(2)16)5-14-11(15-7)3-4-17-6-10(12)13/h5,8,10,16H,3-4,6H2,1-2H3 |
| InChIKey | HOLAKPZGTHKCRN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|