C10H16F2N4O — CID 103150529
[2-[2-(2,2-difluoroethoxy)ethyl]-5,6-dimethylpyrimidin-4-yl]hydrazine (PubChem CID 103150529) has the molecular formula C10H16F2N4O and a molecular weight of 246.26 g/mol. Its IUPAC name is [2-[2-(2,2-difluoroethoxy)ethyl]-5,6-dimethylpyrimidin-4-yl]hydrazine.
| Compound Name | [2-[2-(2,2-difluoroethoxy)ethyl]-5,6-dimethylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 103150529 |
| Molecular Formula | C10H16F2N4O |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | [2-[2-(2,2-difluoroethoxy)ethyl]-5,6-dimethylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(CCOCC(F)F)nc(NN)c1C |
| InChI | InChI=1S/C10H16F2N4O/c1-6-7(2)14-9(15-10(6)16-13)3-4-17-5-8(11)12/h8H,3-5,13H2,1-2H3,(H,14,15,16) |
| InChIKey | PKPMEDQGQCOJHC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|