C12H16F2N4OS — CID 103150509
[2-[2-(2,2-difluoroethoxy)ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 103150509) has the molecular formula C12H16F2N4OS and a molecular weight of 302.35 g/mol. Its IUPAC name is [2-[2-(2,2-difluoroethoxy)ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-[2-(2,2-difluoroethoxy)ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 103150509 |
| Molecular Formula | C12H16F2N4OS |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | [2-[2-(2,2-difluoroethoxy)ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | CCc1cc2c(NN)nc(CCOCC(F)F)nc2s1 |
| InChI | InChI=1S/C12H16F2N4OS/c1-2-7-5-8-11(18-15)16-10(17-12(8)20-7)3-4-19-6-9(13)14/h5,9H,2-4,6,15H2,1H3,(H,16,17,18) |
| InChIKey | LZCZRQSFLNAXGX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|