C10H11F2N3OS — CID 103150235
2-[2-(2,2-difluoroethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103150235) has the molecular formula C10H11F2N3OS and a molecular weight of 259.28 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103150235 |
| Molecular Formula | C10H11F2N3OS |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(CCOCC(F)F)nc2sccc12 |
| InChI | InChI=1S/C10H11F2N3OS/c11-7(12)5-16-3-1-8-14-9(13)6-2-4-17-10(6)15-8/h2,4,7H,1,3,5H2,(H2,13,14,15) |
| InChIKey | YETXINWPPQIGBX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|