C14H22N4OS — CID 116730245
[2-(1-ethoxy-2-methylpropyl)-6-ethylthieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 116730245) has the molecular formula C14H22N4OS and a molecular weight of 294.42 g/mol. Its IUPAC name is [2-(1-ethoxy-2-methylpropyl)-6-ethylthieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(1-ethoxy-2-methylpropyl)-6-ethylthieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 116730245 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [2-(1-ethoxy-2-methylpropyl)-6-ethylthieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | CCOC(c1nc(NN)c2cc(CC)sc2n1)C(C)C |
| InChI | InChI=1S/C14H22N4OS/c1-5-9-7-10-12(18-15)16-13(17-14(10)20-9)11(8(3)4)19-6-2/h7-8,11H,5-6,15H2,1-4H3,(H,16,17,18) |
| InChIKey | XCNPSRKBQZDNAX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|