C13H21N5OS2 — CID 103335739
6-ethyl-2-hydrazinyl-N-(4-methylsulfinylbutan-2-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103335739) has the molecular formula C13H21N5OS2 and a molecular weight of 327.48 g/mol. Its IUPAC name is 6-ethyl-2-hydrazinyl-N-(4-methylsulfinylbutan-2-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-ethyl-2-hydrazinyl-N-(4-methylsulfinylbutan-2-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103335739 |
| Molecular Formula | C13H21N5OS2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 6-ethyl-2-hydrazinyl-N-(4-methylsulfinylbutan-2-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(NC(C)CCS(C)=O)nc(NN)nc2s1 |
| InChI | InChI=1S/C13H21N5OS2/c1-4-9-7-10-11(15-8(2)5-6-21(3)19)16-13(18-14)17-12(10)20-9/h7-8H,4-6,14H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | DPBRWFCBCPQMAU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|