C13H16N6S2 — CID 103333941
6-ethyl-2-hydrazinyl-N-[1-(1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103333941) has the molecular formula C13H16N6S2 and a molecular weight of 320.45 g/mol. Its IUPAC name is 6-ethyl-2-hydrazinyl-N-[1-(1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-ethyl-2-hydrazinyl-N-[1-(1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103333941 |
| Molecular Formula | C13H16N6S2 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 6-ethyl-2-hydrazinyl-N-[1-(1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(NC(C)c3nccs3)nc(NN)nc2s1 |
| InChI | InChI=1S/C13H16N6S2/c1-3-8-6-9-10(16-7(2)11-15-4-5-20-11)17-13(19-14)18-12(9)21-8/h4-7H,3,14H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | RSHWCKRBHFIFMP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|