C13H19N5O2S — CID 103332795
ethyl 2-[(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propanoate (PubChem CID 103332795) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is ethyl 2-[(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propanoate.
| Compound Name | ethyl 2-[(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 103332795 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | ethyl 2-[(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propanoate |
| SMILES | CCOC(=O)C(C)Nc1nc(NN)nc2sc(CC)cc12 |
| InChI | InChI=1S/C13H19N5O2S/c1-4-8-6-9-10(15-7(3)12(19)20-5-2)16-13(18-14)17-11(9)21-8/h6-7H,4-5,14H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | CBLJVCNYWOGJBE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|