C13H22N6S — CID 103335521
2-N-(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)-1-N,1-N-dimethylpropane-1,2-diamine (PubChem CID 103335521) has the molecular formula C13H22N6S and a molecular weight of 294.43 g/mol. Its IUPAC name is 2-N-(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)-1-N,1-N-dimethylpropane-1,2-diamine.
| Compound Name | 2-N-(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)-1-N,1-N-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 103335521 |
| Molecular Formula | C13H22N6S |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-N-(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)-1-N,1-N-dimethylpropane-1,2-diamine |
| SMILES | CCc1cc2c(NC(C)CN(C)C)nc(NN)nc2s1 |
| InChI | InChI=1S/C13H22N6S/c1-5-9-6-10-11(15-8(2)7-19(3)4)16-13(18-14)17-12(10)20-9/h6,8H,5,7,14H2,1-4H3,(H2,15,16,17,18) |
| InChIKey | WJVZXFYDWOVBRL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|