C11H15F2N5S — CID 103335769
N-(2,2-difluoroethyl)-6-ethyl-2-hydrazinyl-N-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 103335769) has the molecular formula C11H15F2N5S and a molecular weight of 287.34 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-6-ethyl-2-hydrazinyl-N-methylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2,2-difluoroethyl)-6-ethyl-2-hydrazinyl-N-methylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103335769 |
| Molecular Formula | C11H15F2N5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-(2,2-difluoroethyl)-6-ethyl-2-hydrazinyl-N-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(N(C)CC(F)F)nc(NN)nc2s1 |
| InChI | InChI=1S/C11H15F2N5S/c1-3-6-4-7-9(18(2)5-8(12)13)15-11(17-14)16-10(7)19-6/h4,8H,3,5,14H2,1-2H3,(H,15,16,17) |
| InChIKey | JFZKZDZGIUFDLU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|