C14H23N5S — CID 103335029
6-ethyl-2-hydrazinyl-N,N-dipropylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 103335029) has the molecular formula C14H23N5S and a molecular weight of 293.44 g/mol. Its IUPAC name is 6-ethyl-2-hydrazinyl-N,N-dipropylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-ethyl-2-hydrazinyl-N,N-dipropylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103335029 |
| Molecular Formula | C14H23N5S |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 6-ethyl-2-hydrazinyl-N,N-dipropylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCN(CCC)c1nc(NN)nc2sc(CC)cc12 |
| InChI | InChI=1S/C14H23N5S/c1-4-7-19(8-5-2)12-11-9-10(6-3)20-13(11)17-14(16-12)18-15/h9H,4-8,15H2,1-3H3,(H,16,17,18) |
| InChIKey | DFGXACISYFCXMW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|