C10H15N5S — CID 103335153
N,6-diethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 103335153) has the molecular formula C10H15N5S and a molecular weight of 237.33 g/mol. Its IUPAC name is N,6-diethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N,6-diethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103335153 |
| Molecular Formula | C10H15N5S |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N,6-diethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCNc1nc(NN)nc2sc(CC)cc12 |
| InChI | InChI=1S/C10H15N5S/c1-3-6-5-7-8(12-4-2)13-10(15-11)14-9(7)16-6/h5H,3-4,11H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | OCDDINNUYZDBSS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|