C12H15N7OS — CID 106412380
6-ethyl-2-hydrazinyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 106412380) has the molecular formula C12H15N7OS and a molecular weight of 305.37 g/mol. Its IUPAC name is 6-ethyl-2-hydrazinyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-ethyl-2-hydrazinyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106412380 |
| Molecular Formula | C12H15N7OS |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 6-ethyl-2-hydrazinyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(NCc3noc(C)n3)nc(NN)nc2s1 |
| InChI | InChI=1S/C12H15N7OS/c1-3-7-4-8-10(14-5-9-15-6(2)20-19-9)16-12(18-13)17-11(8)21-7/h4H,3,5,13H2,1-2H3,(H2,14,16,17,18) |
| InChIKey | AGRZXGIBQUOUPW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|