C12H17N5O2S — CID 103332518
methyl 3-[(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propanoate (PubChem CID 103332518) has the molecular formula C12H17N5O2S and a molecular weight of 295.37 g/mol. Its IUPAC name is methyl 3-[(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propanoate.
| Compound Name | methyl 3-[(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 103332518 |
| Molecular Formula | C12H17N5O2S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | methyl 3-[(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propanoate |
| SMILES | CCc1cc2c(NCCC(=O)OC)nc(NN)nc2s1 |
| InChI | InChI=1S/C12H17N5O2S/c1-3-7-6-8-10(14-5-4-9(18)19-2)15-12(17-13)16-11(8)20-7/h6H,3-5,13H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | ULOTXLHOBMDZTR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|