C13H15N5S2 — CID 63614519
[6-ethyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 63614519) has the molecular formula C13H15N5S2 and a molecular weight of 305.43 g/mol. Its IUPAC name is [6-ethyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [6-ethyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 63614519 |
| Molecular Formula | C13H15N5S2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | [6-ethyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | CCc1cc2c(NN)nc(Cc3csc(C)n3)nc2s1 |
| InChI | InChI=1S/C13H15N5S2/c1-3-9-5-10-12(18-14)16-11(17-13(10)20-9)4-8-6-19-7(2)15-8/h5-6H,3-4,14H2,1-2H3,(H,16,17,18) |
| InChIKey | ZAGCIVMGPOFTOU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|