C15H25F2N3O — CID 103150808
N-[2-[2-[2-(2,2-difluoroethoxy)ethyl]-4,6-dimethylpyrimidin-5-yl]ethyl]propan-2-amine (PubChem CID 103150808) has the molecular formula C15H25F2N3O and a molecular weight of 301.38 g/mol. Its IUPAC name is N-[2-[2-[2-(2,2-difluoroethoxy)ethyl]-4,6-dimethylpyrimidin-5-yl]ethyl]propan-2-amine.
| Compound Name | N-[2-[2-[2-(2,2-difluoroethoxy)ethyl]-4,6-dimethylpyrimidin-5-yl]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 103150808 |
| Molecular Formula | C15H25F2N3O |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | N-[2-[2-[2-(2,2-difluoroethoxy)ethyl]-4,6-dimethylpyrimidin-5-yl]ethyl]propan-2-amine |
| SMILES | Cc1nc(CCOCC(F)F)nc(C)c1CCNC(C)C |
| InChI | InChI=1S/C15H25F2N3O/c1-10(2)18-7-5-13-11(3)19-15(20-12(13)4)6-8-21-9-14(16)17/h10,14,18H,5-9H2,1-4H3 |
| InChIKey | YUMLKSCTCLQHKV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|