C8H11F3N4 — CID 62252952
[5,6-dimethyl-2-(2,2,2-trifluoroethyl)pyrimidin-4-yl]hydrazine (PubChem CID 62252952) has the molecular formula C8H11F3N4 and a molecular weight of 220.20 g/mol. Its IUPAC name is [5,6-dimethyl-2-(2,2,2-trifluoroethyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [5,6-dimethyl-2-(2,2,2-trifluoroethyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62252952 |
| Molecular Formula | C8H11F3N4 |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | [5,6-dimethyl-2-(2,2,2-trifluoroethyl)pyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(CC(F)(F)F)nc(NN)c1C |
| InChI | InChI=1S/C8H11F3N4/c1-4-5(2)13-6(3-8(9,10)11)14-7(4)15-12/h3,12H2,1-2H3,(H,13,14,15) |
| InChIKey | IFEHWLLXVKZSCK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|