C9H12F2N2O4 — CID 103146501
ethyl 3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole-5-carboxylate (PubChem CID 103146501) has the molecular formula C9H12F2N2O4 and a molecular weight of 250.20 g/mol. Its IUPAC name is ethyl 3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole-5-carboxylate.
| Compound Name | ethyl 3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole-5-carboxylate |
|---|---|
| PubChem CID | 103146501 |
| Molecular Formula | C9H12F2N2O4 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | ethyl 3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(CCOCC(F)F)no1 |
| InChI | InChI=1S/C9H12F2N2O4/c1-2-16-9(14)8-12-7(13-17-8)3-4-15-5-6(10)11/h6H,2-5H2,1H3 |
| InChIKey | KQSCFAWNQQFELT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|