C12H17F2NO4 — CID 103213413
ethyl 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,3-oxazole-5-carboxylate (PubChem CID 103213413) has the molecular formula C12H17F2NO4 and a molecular weight of 277.27 g/mol. Its IUPAC name is ethyl 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,3-oxazole-5-carboxylate.
| Compound Name | ethyl 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 103213413 |
| Molecular Formula | C12H17F2NO4 |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | ethyl 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1oc(CCOCC(F)F)nc1CC |
| InChI | InChI=1S/C12H17F2NO4/c1-3-8-11(12(16)18-4-2)19-10(15-8)5-6-17-7-9(13)14/h9H,3-7H2,1-2H3 |
| InChIKey | OOKNAQFHZUHBAZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|