C9H8F5NO4 — CID 103213461
2-[2-(2,2-difluoroethoxy)ethyl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid (PubChem CID 103213461) has the molecular formula C9H8F5NO4 and a molecular weight of 289.16 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 103213461 |
| Molecular Formula | C9H8F5NO4 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1oc(CCOCC(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C9H8F5NO4/c10-4(11)3-18-2-1-5-15-7(9(12,13)14)6(19-5)8(16)17/h4H,1-3H2,(H,16,17) |
| InChIKey | FXCBLDMSQCGIQF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|