C9H7F6NO4 — CID 103213460
2-[2-(2,2,2-trifluoroethoxy)ethyl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid (PubChem CID 103213460) has the molecular formula C9H7F6NO4 and a molecular weight of 307.15 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethoxy)ethyl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid.
| Compound Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 103213460 |
| Molecular Formula | C9H7F6NO4 |
| Molecular Weight | 307.15 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1oc(CCOCC(F)(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C9H7F6NO4/c10-8(11,12)3-19-2-1-4-16-6(9(13,14)15)5(20-4)7(17)18/h1-3H2,(H,17,18) |
| InChIKey | SODIUESEXPGIBF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.15 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|