C11H12F5NO4 — CID 103213463
ethyl 2-[2-(2,2-difluoroethoxy)ethyl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylate (PubChem CID 103213463) has the molecular formula C11H12F5NO4 and a molecular weight of 317.21 g/mol. Its IUPAC name is ethyl 2-[2-(2,2-difluoroethoxy)ethyl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylate.
| Compound Name | ethyl 2-[2-(2,2-difluoroethoxy)ethyl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 103213463 |
| Molecular Formula | C11H12F5NO4 |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | ethyl 2-[2-(2,2-difluoroethoxy)ethyl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1oc(CCOCC(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C11H12F5NO4/c1-2-20-10(18)8-9(11(14,15)16)17-7(21-8)3-4-19-5-6(12)13/h6H,2-5H2,1H3 |
| InChIKey | BMQWPIFRHYZROO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|