C9H9F5N2O3 — CID 103150951
3-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1,1,1-trifluoropropan-2-one (PubChem CID 103150951) has the molecular formula C9H9F5N2O3 and a molecular weight of 288.17 g/mol. Its IUPAC name is 3-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1,1,1-trifluoropropan-2-one.
| Compound Name | 3-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 103150951 |
| Molecular Formula | C9H9F5N2O3 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 3-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-1,1,1-trifluoropropan-2-one |
| SMILES | O=C(Cc1nc(CCOCC(F)F)no1)C(F)(F)F |
| InChI | InChI=1S/C9H9F5N2O3/c10-6(11)4-18-2-1-7-15-8(19-16-7)3-5(17)9(12,13)14/h6H,1-4H2 |
| InChIKey | QYUNAQCHODGUGZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|