C13H12F2N2O4 — CID 103146492
4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]benzoic acid (PubChem CID 103146492) has the molecular formula C13H12F2N2O4 and a molecular weight of 298.24 g/mol. Its IUPAC name is 4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]benzoic acid.
| Compound Name | 4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 103146492 |
| Molecular Formula | C13H12F2N2O4 |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nc(CCOCC(F)F)no2)cc1 |
| InChI | InChI=1S/C13H12F2N2O4/c14-10(15)7-20-6-5-11-16-12(21-17-11)8-1-3-9(4-2-8)13(18)19/h1-4,10H,5-7H2,(H,18,19) |
| InChIKey | POUQPZRKXURLRR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|