C13H14F2N2O4 — CID 136842510
4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-2-methoxyphenol (PubChem CID 136842510) has the molecular formula C13H14F2N2O4 and a molecular weight of 300.26 g/mol. Its IUPAC name is 4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-2-methoxyphenol.
| Compound Name | 4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 136842510 |
| Molecular Formula | C13H14F2N2O4 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-2-methoxyphenol |
| SMILES | COc1cc(-c2nc(CCOCC(F)F)no2)ccc1O |
| InChI | InChI=1S/C13H14F2N2O4/c1-19-10-6-8(2-3-9(10)18)13-16-12(17-21-13)4-5-20-7-11(14)15/h2-3,6,11,18H,4-5,7H2,1H3 |
| InChIKey | BWKOLOWZBDYKBU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 77.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|