C12H14F2N4O2 — CID 103146171
[6-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-3-pyridinyl]methanamine (PubChem CID 103146171) has the molecular formula C12H14F2N4O2 and a molecular weight of 284.27 g/mol. Its IUPAC name is [6-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-3-pyridinyl]methanamine.
| Compound Name | [6-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 103146171 |
| Molecular Formula | C12H14F2N4O2 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | [6-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-3-pyridinyl]methanamine |
| SMILES | NCc1ccc(-c2nc(CCOCC(F)F)no2)nc1 |
| InChI | InChI=1S/C12H14F2N4O2/c13-10(14)7-19-4-3-11-17-12(20-18-11)9-2-1-8(5-15)6-16-9/h1-2,6,10H,3-5,7,15H2 |
| InChIKey | SRUQTRDXPLALQB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|