About [6-(3-propyl-1,2,4-oxadiazol-5-yl)-3-pyridinyl]methanamine
[6-(3-propyl-1,2,4-oxadiazol-5-yl)-3-pyridinyl]methanamine (PubChem CID 81098785) has the molecular formula C11H14N4O
and a molecular weight of 218.26 g/mol. Its IUPAC name is [6-(3-propyl-1,2,4-oxadiazol-5-yl)-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [6-(3-propyl-1,2,4-oxadiazol-5-yl)-3-pyridinyl]methanamine |
| PubChem CID | 81098785 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | [6-(3-propyl-1,2,4-oxadiazol-5-yl)-3-pyridinyl]methanamine |
| SMILES | CCCc1noc(-c2ccc(CN)cn2)n1 |
| InChI | InChI=1S/C11H14N4O/c1-2-3-10-14-11(16-15-10)9-5-4-8(6-12)7-13-9/h4-5,7H,2-3,6,12H2,1H3 |
| InChIKey | CJUSIESCYVMDIL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-(3-propyl-1,2,4-oxadiazol-5-yl)-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(3-propyl-1,2,4-oxadiazol-5-yl)-3-pyridinyl]methanamine?
The IUPAC name of [6-(3-propyl-1,2,4-oxadiazol-5-yl)-3-pyridinyl]methanamine (CID 81098785) is [6-(3-propyl-1,2,4-oxadiazol-5-yl)-3-pyridinyl]methanamine.
What is the SMILES notation for [6-(3-propyl-1,2,4-oxadiazol-5-yl)-3-pyridinyl]methanamine?
The canonical SMILES for [6-(3-propyl-1,2,4-oxadiazol-5-yl)-3-pyridinyl]methanamine is CCCc1noc(-c2ccc(CN)cn2)n1.
What is the InChIKey of [6-(3-propyl-1,2,4-oxadiazol-5-yl)-3-pyridinyl]methanamine?
The InChIKey is CJUSIESCYVMDIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O/c1-2-3-10-14-11(16-15-10)9-5-4-8(6-12)7-13-9/h4-5,7H,2-3,6,12H2,1H3.
What are the key properties of [6-(3-propyl-1,2,4-oxadiazol-5-yl)-3-pyridinyl]methanamine?
[6-(3-propyl-1,2,4-oxadiazol-5-yl)-3-pyridinyl]methanamine has a molecular weight of 218.26 g/mol, XLogP of 1.54, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(3-propyl-1,2,4-oxadiazol-5-yl)-3-pyridinyl]methanamine is sourced from PubChem (CID 81098785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).