C9H12F2N2O — CID 82006174
[6-(2,2-difluoroethoxymethyl)-3-pyridinyl]methanamine (PubChem CID 82006174) has the molecular formula C9H12F2N2O and a molecular weight of 202.20 g/mol. Its IUPAC name is [6-(2,2-difluoroethoxymethyl)-3-pyridinyl]methanamine.
| Compound Name | [6-(2,2-difluoroethoxymethyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 82006174 |
| Molecular Formula | C9H12F2N2O |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | [6-(2,2-difluoroethoxymethyl)-3-pyridinyl]methanamine |
| SMILES | NCc1ccc(COCC(F)F)nc1 |
| InChI | InChI=1S/C9H12F2N2O/c10-9(11)6-14-5-8-2-1-7(3-12)4-13-8/h1-2,4,9H,3,5-6,12H2 |
| InChIKey | GZOAQMMFOIYBSG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |