C9H11F2NO — CID 60921613
4-(2,2-difluoroethoxymethyl)aniline (PubChem CID 60921613) has the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxymethyl)aniline.
| Compound Name | 4-(2,2-difluoroethoxymethyl)aniline |
|---|---|
| PubChem CID | 60921613 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 4-(2,2-difluoroethoxymethyl)aniline |
| SMILES | Nc1ccc(COCC(F)F)cc1 |
| InChI | InChI=1S/C9H11F2NO/c10-9(11)6-13-5-7-1-3-8(12)4-2-7/h1-4,9H,5-6,12H2 |
| InChIKey | QZVGALBGOHTYRC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|