C8H13F2N3O2 — CID 103211755
2-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]ethanamine (PubChem CID 103211755) has the molecular formula C8H13F2N3O2 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]ethanamine.
| Compound Name | 2-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 103211755 |
| Molecular Formula | C8H13F2N3O2 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]ethanamine |
| SMILES | NCCc1noc(CCOCC(F)F)n1 |
| InChI | InChI=1S/C8H13F2N3O2/c9-6(10)5-14-4-2-8-12-7(1-3-11)13-15-8/h6H,1-5,11H2 |
| InChIKey | ARVJMVOSNVFOHZ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|