C9H15F2N3O2 — CID 103211768
2-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]propan-1-amine (PubChem CID 103211768) has the molecular formula C9H15F2N3O2 and a molecular weight of 235.23 g/mol. Its IUPAC name is 2-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]propan-1-amine.
| Compound Name | 2-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 103211768 |
| Molecular Formula | C9H15F2N3O2 |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]propan-1-amine |
| SMILES | CC(CN)c1noc(CCOCC(F)F)n1 |
| InChI | InChI=1S/C9H15F2N3O2/c1-6(4-12)9-13-8(16-14-9)2-3-15-5-7(10)11/h6-7H,2-5,12H2,1H3 |
| InChIKey | PJTSYGMAXAHIFO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|