C13H21F2N3O2 — CID 103211741
1-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]-4-methylcyclohexan-1-amine (PubChem CID 103211741) has the molecular formula C13H21F2N3O2 and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]-4-methylcyclohexan-1-amine.
| Compound Name | 1-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]-4-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 103211741 |
| Molecular Formula | C13H21F2N3O2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]-4-methylcyclohexan-1-amine |
| SMILES | CC1CCC(N)(c2noc(CCOCC(F)F)n2)CC1 |
| InChI | InChI=1S/C13H21F2N3O2/c1-9-2-5-13(16,6-3-9)12-17-11(20-18-12)4-7-19-8-10(14)15/h9-10H,2-8,16H2,1H3 |
| InChIKey | DMYYWURXANQOBO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|