C17H31N3O — CID 65426791
4-methyl-1-(5-octyl-1,2,4-oxadiazol-3-yl)cyclohexan-1-amine (PubChem CID 65426791) has the molecular formula C17H31N3O and a molecular weight of 293.45 g/mol. Its IUPAC name is 4-methyl-1-(5-octyl-1,2,4-oxadiazol-3-yl)cyclohexan-1-amine.
| Compound Name | 4-methyl-1-(5-octyl-1,2,4-oxadiazol-3-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 65426791 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 4-methyl-1-(5-octyl-1,2,4-oxadiazol-3-yl)cyclohexan-1-amine |
| SMILES | CCCCCCCCc1nc(C2(N)CCC(C)CC2)no1 |
| InChI | InChI=1S/C17H31N3O/c1-3-4-5-6-7-8-9-15-19-16(20-21-15)17(18)12-10-14(2)11-13-17/h14H,3-13,18H2,1-2H3 |
| InChIKey | RGSRNKPTEABSCE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|