C6H7BrF2N2O2 — CID 103211790
3-bromo-5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole (PubChem CID 103211790) has the molecular formula C6H7BrF2N2O2 and a molecular weight of 257.03 g/mol. Its IUPAC name is 3-bromo-5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole.
| Compound Name | 3-bromo-5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103211790 |
| Molecular Formula | C6H7BrF2N2O2 |
| Molecular Weight | 257.03 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 3-bromo-5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole |
| SMILES | FC(F)COCCc1nc(Br)no1 |
| InChI | InChI=1S/C6H7BrF2N2O2/c7-6-10-5(13-11-6)1-2-12-3-4(8)9/h4H,1-3H2 |
| InChIKey | UIIBMQFYSAEQIT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.03 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|