C8H13F2N3O3 — CID 103211802
2-amino-2-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 103211802) has the molecular formula C8H13F2N3O3 and a molecular weight of 237.21 g/mol. Its IUPAC name is 2-amino-2-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 2-amino-2-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 103211802 |
| Molecular Formula | C8H13F2N3O3 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-amino-2-[5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | NC(CO)c1noc(CCOCC(F)F)n1 |
| InChI | InChI=1S/C8H13F2N3O3/c9-6(10)4-15-2-1-7-12-8(13-16-7)5(11)3-14/h5-6,14H,1-4,11H2 |
| InChIKey | VETXESNRZWAROV-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|