C11H18F3N3O3 — CID 103211816
2-propan-2-yloxy-1-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]ethanamine (PubChem CID 103211816) has the molecular formula C11H18F3N3O3 and a molecular weight of 297.28 g/mol. Its IUPAC name is 2-propan-2-yloxy-1-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]ethanamine.
| Compound Name | 2-propan-2-yloxy-1-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 103211816 |
| Molecular Formula | C11H18F3N3O3 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-propan-2-yloxy-1-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]ethanamine |
| SMILES | CC(C)OCC(N)c1noc(CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C11H18F3N3O3/c1-7(2)19-5-8(15)10-16-9(20-17-10)3-4-18-6-11(12,13)14/h7-8H,3-6,15H2,1-2H3 |
| InChIKey | ZXYHZLNQTQGTCO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|