C12H20F3N3O3 — CID 103211850
1-propan-2-yloxy-2-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]propan-2-amine (PubChem CID 103211850) has the molecular formula C12H20F3N3O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is 1-propan-2-yloxy-2-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]propan-2-amine.
| Compound Name | 1-propan-2-yloxy-2-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]propan-2-amine |
|---|---|
| PubChem CID | 103211850 |
| Molecular Formula | C12H20F3N3O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 1-propan-2-yloxy-2-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-3-yl]propan-2-amine |
| SMILES | CC(C)OCC(C)(N)c1noc(CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H20F3N3O3/c1-8(2)20-6-11(3,16)10-17-9(21-18-10)4-5-19-7-12(13,14)15/h8H,4-7,16H2,1-3H3 |
| InChIKey | BRIUGCBRAGUQGM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|