C10H19N3O3 — CID 104633999
2-ethoxy-1-[5-(2-ethoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine (PubChem CID 104633999) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-ethoxy-1-[5-(2-ethoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine.
| Compound Name | 2-ethoxy-1-[5-(2-ethoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 104633999 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 2-ethoxy-1-[5-(2-ethoxyethyl)-1,2,4-oxadiazol-3-yl]ethanamine |
| SMILES | CCOCCc1nc(C(N)COCC)no1 |
| InChI | InChI=1S/C10H19N3O3/c1-3-14-6-5-9-12-10(13-16-9)8(11)7-15-4-2/h8H,3-7,11H2,1-2H3 |
| InChIKey | IOTWZALFBUURPE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|